PRODUCT Properties
| Melting point: | 245-246℃ |
| Boiling point: | 639.6±55.0 °C(Predicted) |
| Density | 1.501 |
| storage temp. | 2-8°C |
| solubility | DMSO:100.0(Max Conc. mg/mL);283.85(Max Conc. mM) |
| form | A crystalline solid |
| pka | 7.53±0.20(Predicted) |
| color | Off-white to light yellow |
| Major Application | food and beverages |
| InChI | 1S/C19H12O7/c1-23-16-6-11-7-17(19(22)26-15(11)9-13(16)20)24-12-4-2-10-3-5-18(21)25-14(10)8-12/h2-9,20H,1H3 |
| InChIKey | JRHMMVBOTXEHGJ-UHFFFAOYSA-N |
| SMILES | [o]1c2c(cc([c]1=O)Oc3cc4[o][c](ccc4cc3)=O)cc(c(c2)O)OC |
Description and Uses
Daphnoretin is an active constituent of Wikstroemia indica C. A. Meys which possesses anti-cancer activity. Inhibitory effect on mitosis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319 |
| Precautionary statements | P501-P261-P270-P271-P264-P280-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330-P302+P352+P312-P304+P340+P312 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
