PRODUCT Properties
| Melting point: | 145-146℃ |
| Boiling point: | 601.4±55.0 °C(Predicted) |
| Density | 1.304±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | 2-8°C |
| solubility | Soluble in methan |
| form | powder |
| pka | 6.81±0.40(Predicted) |
| color | Yellow |
| Major Application | food and beverages |
| InChI | InChI=1S/C20H20O8/c1-23-12-7-6-10(8-14(12)24-2)13-9-11(21)15-16(22)18(25-3)20(27-5)19(26-4)17(15)28-13/h6-9,22H,1-5H3 |
| InChIKey | DOFJNFPSMUCECH-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(OC)C(OC)=C2)OC2=C(OC)C(OC)=C(OC)C(O)=C2C(=O)C=1 |
Description and Uses
2-(3,4-Dimethoxyphenyl)-5-hydroxy-6,7,8-trimethoxy-4H-chromen-4-one is used in the treatment of neurodegenerative and metabolic disorders
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |






