PRODUCT Properties
| Melting point: | 133 °C |
| Boiling point: | 452.0±45.0 °C(Predicted) |
| Density | 1.160±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO: ≥ 250 mg/mL (765.95 mM) |
| form | powder |
| pka | 9.80±0.35(Predicted) |
| color | White |
| Major Application | food and beverages |
| InChI | 1S/C20H22O4/c1-5-6-13-9-15-12(2)19(24-20(15)18(10-13)23-4)14-7-8-16(21)17(11-14)22-3/h5-12,19,21H,1-4H3/b6-5- |
| InChIKey | ITDOFWOJEDZPCF-WAYWQWQTSA-N |
| SMILES | O1C(C(c3c1c(cc(c3)\C=C/C)OC)C)c2cc(c(cc2)O)OC |
| LogP | 4.188 (est) |
Description and Uses
Dehydrodiisoeugenol is a peroxisome proliferator-activated receptor (PPARS) agonist. An antidiabetic drug. It is an anxiogenic agent in cerebral nucleus of rat.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | WGK 3 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
