PRODUCT Properties
| Melting point: | 104-106℃ (ethanol ) |
| Boiling point: | 431.17°C (rough estimate) |
| Density | 1.0474 (rough estimate) |
| refractive index | 1.4860 (estimate) |
| solubility | DMSO: 62.5 mg/mL (162.54 mM) |
| form | powder to crystal |
| color | White to Almost white |
| Merck | 13,3738 |
| InChIKey | JQIYNMYZKRGDFK-ZVIGJAPXNA-N |
| SMILES | [C@@]12([H])CC[C@H](OC(=O)CC)[C@@]1(C)CC[C@]1([H])C3C=CC(OC(=O)CC)=CC=3CC[C@@]21[H] |&1:0,4,10,14,29,r| |
Description and Uses
beta-Estradiol 3,17-dipropionate is used in the study of nutrient-sensitized screening for drugs that shift energy metabolism from mitochondrial respiration to glycolysis.
