PRODUCT Properties
| Melting point: | 142-144 |
| Boiling point: | 363.31°C (rough estimate) |
| Density | 1.2053 (rough estimate) |
| refractive index | 1.5330 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO : ≥ 3 mg/mL (11.69 mM) |
| form | Solid |
| pka | pKa 3.59(H2O t=25.0±0.1 I=0.1) (Uncertain) |
| color | White to off-white |
| InChI | InChI=1S/C15H9ClO2/c16-10-7-5-9(6-8-10)13-14(17)11-3-1-2-4-12(11)15(13)18/h1-8,13H |
| InChIKey | NJDUWAXIURWWLN-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C(=O)C1C1=CC=C(Cl)C=C1 |
Description and Uses
antcoagulant, Vitamine K antagonist
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P280-P301+P310-P362+P364 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 2811 |
| Hazard Note | Irritant |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2914199090 |
| Toxicity | LD50 orally in mice: 1220 mg/kg (Fontaine) |
