A7066658
Benzylcinnamate , 10mMinDMSO , 103-41-3
Synonym(s):
3-Phenyl 2-propenoic acid benzyl ester;Benzyl 3-phenylpropenoate;Benzyl cinnamate;Benzyl trans-3-phenylpropenoate;Cinnamic acid benzyl ester
CAS NO.:103-41-3
Empirical Formula: C16H14O2
Molecular Weight: 238.28
MDL number: MFCD00004789
EINECS: 203-109-3
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 34-37 °C (lit.) |
| Boiling point: | 195-200 °C/5 mmHg (lit.) |
| Density | 1.11 |
| vapor pressure | <0.1 hPa (20 °C) |
| FEMA | 2142 | BENZYL CINNAMATE |
| refractive index | 1.4025-1.4045 |
| Flash point: | >230 °F |
| storage temp. | Store below +30°C. |
| solubility | alcohol: soluble(lit.) |
| form | Crystalline Mass or Liquid After Melting |
| color | Clear colorless to yellow |
| Odor | aromatic odor |
| Odor Type | balsamic |
| biological source | synthetic |
| Water Solubility | PRACTICALLY INSOLUBLE |
| Merck | 14,1130 |
| JECFA Number | 670 |
| BRN | 2051339 |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C16H14O2/c17-16(12-11-14-7-3-1-4-8-14)18-13-15-9-5-2-6-10-15/h1-12H,13H2/b12-11+ |
| InChIKey | NGHOLYJTSCBCGC-VAWYXSNFSA-N |
| SMILES | O=C(OCC1=CC=CC=C1)/C=C/C2=CC=CC=C2 |
| LogP | 4.18 at 23.7℃ |
| CAS DataBase Reference | 103-41-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzyl cinnamate(103-41-3) |
| EPA Substance Registry System | Benzyl cinnamate (103-41-3) |
Description and Uses
Benzyl cinnamate has been employed as internal standard during the determination of compounds commonly added to personal care products such as UV filters and antimicrobial agents in environmental samples.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H410 |
| Precautionary statements | P261-P272-P273-P280-P302+P352-P333+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25 |
| RIDADR | 3077 |
| WGK Germany | 2 |
| RTECS | GD8400000 |
| TSCA | TSCA listed |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 2 Skin Sens. 1B |
| Hazardous Substances Data | 103-41-3(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: 5530 mg/kg (Jenner) |






