PRODUCT Properties
| Melting point: | 170 °C (dec.)(lit.) |
| Boiling point: | 397.76°C (rough estimate) |
| alpha | D20 +27.3° +75.8° (c = 4 in water) |
| Density | 1.4149 (rough estimate) |
| refractive index | 75.5 ° (C=4, H2O) |
| storage temp. | -20°C Freezer |
| solubility | H2O: 0.1 g/mL, clear, colorless |
| form | Solid |
| pka | 12.67±0.10(Predicted) |
| color | White |
| biological source | synthetic |
| optical activity | +22 → +75 |
| Water Solubility | Soluble in water and methanol. |
| Merck | 14,9821 |
| BRN | 93771 |
| InChI | 1S/C12H22O11/c13-1-5-7(17)8(18)9(19)11(22-5)23-10-6(16)4(15)2-21-12(10,20)3-14/h4-11,13-20H,1-3H2/t4-,5-,6-,7-,8+,9-,10+,11-,12/m1/s1 |
| InChIKey | SEWFWJUQVJHATO-PUVWEJBASA-N |
| SMILES | OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@@H](O)COC2(O)CO)[C@H](O)[C@@H](O)[C@@H]1O |
| CAS DataBase Reference | 547-25-1(CAS DataBase Reference) |
| EPA Substance Registry System | D-Fructose, 3-O-.alpha.-D-glucopyranosyl- (547-25-1) |
Description and Uses
D-Turanose is used as a carbon source by bacteria, fungi, and other organisms. It is involved in intracellular sugar signaling in plant cells.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 22-36/37/38-37/38-41 |
| Safety Statements | 24/25-36/37/39-36-26 |
| WGK Germany | 3 |
| F | 3-10 |
| TSCA | TSCA listed |
| HS Code | 29400000 |
| Storage Class | 11 - Combustible Solids |



