A7068258
Adenosine5′-diphosphatesodiumsalt , 10mMinWater , 20398-34-9
Synonym(s):
ADP
CAS NO.:20398-34-9
Empirical Formula: C10H16N5NaO10P2
Molecular Weight: 451.2
MDL number: MFCD00065470
EINECS: 2017-001-1
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >174°C (dec.) |
| Boiling point: | 877.7° |
| Flash point: | 484.6° |
| storage temp. | -20°C |
| solubility | Aquoues Base (Slightly), Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | White to Off-White |
| biological source | bacterial |
| Water Solubility | water: 50mg/mL |
| Stability: | Hygroscopic |
| InChIKey | NAZRYZKZIIRXMG-JHVGCDEENA-N |
| SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)(=O)OP(O)(O)=O)O[C@H]1N1C=NC2C(=NC=NC1=2)N)O.[NaH] |&1:1,2,3,15,r| |
| CAS DataBase Reference | 20398-34-9(CAS DataBase Reference) |
Description and Uses
Adenosine 5′-diphosphate sodium salt (ADP-NA) is an adenine nucleotide phosphorylated into ATP by ATPase. This phosphorylation is a crucial part of cellular homeostatis as it allows energy storage and is involved in nucleic acid metabolism.
Adenosine 5'-diphosphate sodium salt (ADP-NA) is a nucleoside diphosphate, which is the product of ATP dephosphorylation by ATPases. Adenosine 5'-diphosphate sodium salt induces human platelet aggregation and inhibits stimulated adenylate cyclase by an action at P2T-purinoceptors[1][2][3].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-68/20/21/22 |
| Safety Statements | 36/37-24/25 |
| WGK Germany | 1 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |







