PRODUCT Properties
| Melting point: | 79.5-80° |
| Boiling point: | 381.7°C (rough estimate) |
| Density | 0.9914 (rough estimate) |
| refractive index | 1.4800 (estimate) |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 14.95±0.40(Predicted) |
| form | Solid |
| color | White to Pale Yellow |
| Merck | 14,291 |
| InChI | InChI=1/C21H32O/c1-3-12-21(22)14-11-19-18-9-8-15-6-4-5-7-16(15)17(18)10-13-20(19,21)2/h3,6,16-19,22H,1,4-5,7-14H2,2H3/t16-,17+,18+,19-,20-,21-/s3 |
| InChIKey | ATXHVCQZZJYMCF-HABXDNTMNA-N |
| SMILES | [C@@]12([H])CC[C@@](O)(CC=C)[C@@]1(C)CC[C@]1([H])[C@@]3([H])CCCC=C3CC[C@@]21[H] |&1:0,4,9,13,15,24,r| |
| CAS DataBase Reference | 432-60-0(CAS DataBase Reference) |
Description and Uses
A synthetic steroid with progestational activity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| RTECS | KG7960000 |
