A7080858
Citral , 10mMinDMSO , 5392-40-5
Synonym(s):
3,7-Dimethyl-2,6-octadienal;Citral;Geranial and neral mixture;Lemonal
CAS NO.:5392-40-5
Empirical Formula: C10H16O
Molecular Weight: 152.23
MDL number: MFCD00006997
EINECS: 226-394-6
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <-10°C |
| Boiling point: | 229 °C (lit.) |
| Density | 0.888 g/mL at 25 °C (lit.) |
| vapor density | 5 (vs air) |
| vapor pressure | 0.2 mm Hg ( 200 °C) |
| FEMA | 2303 | CITRAL |
| refractive index | n |
| Flash point: | 215 °F |
| storage temp. | 2-8°C |
| solubility | 0.42g/l |
| form | Liquid |
| color | colorless to light yellow |
| Odor | at 100.00 %. sweet lemon citral |
| Odor Type | citrus |
| biological source | synthetic |
| explosive limit | 4.3-9.9%(V) |
| Water Solubility | PRACTICALLY INSOLUBLE |
| Merck | 14,2322 |
| JECFA Number | 1225 |
| BRN | 1721871 |
| Exposure limits | ACGIH: TWA 5 ppm (Skin) |
| Stability: | Stable. but readily isomerizes. Incompatible with alkalies, strong oxidizing agents, strong acids. Combustible. Air and light sensitive. |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | FLAVOURING FRAGRANCE PERFUMING |
| InChI | 1S/C10H16O/c1-9(2)5-4-6-10(3)7-8-11/h5,7-8H,4,6H2,1-3H3 |
| InChIKey | WTEVQBCEXWBHNA-UHFFFAOYSA-N |
| SMILES | [H]C(=O)C=C(C)CC\C=C(\C)C |
| LogP | 2.76 at 25℃ |
| CAS DataBase Reference | 5392-40-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Citral(5392-40-5) |
| EPA Substance Registry System | Citral (5392-40-5) |
Description and Uses
Citral is an anti-microbial agent found in plants with antibacterial activity against some food pathogens. It is also a fragrance compound with a distinct lemon scent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319 |
| Precautionary statements | P261-P264-P272-P280-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 38-43 |
| Safety Statements | 24/25-37 |
| RIDADR | 1760 |
| WGK Germany | 1 |
| RTECS | RG5075000 |
| Autoignition Temperature | 225 °C |
| TSCA | TSCA listed |
| HS Code | 2912 19 00 |
| HazardClass | 8 |
| PackingGroup | III |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
| Hazardous Substances Data | 5392-40-5(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: 4.96 g/kg (Opdyke) |





