A7092258
Angelicin , 10mMinDMSO , 523-50-2
Synonym(s):
2H-Furo[2,3-h]-1-benzopyran-2-one;2-Oxo-(2H)-furo(2,3-h)-1-benzopyran;Isopsoralen;NSC 404563
CAS NO.:523-50-2
Empirical Formula: C11H6O3
Molecular Weight: 186.16
MDL number: MFCD00064930
EINECS: 637-055-0
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 132-134°C |
| Boiling point: | 104°C/4mmHg(lit.) |
| Density | 1.2477 (rough estimate) |
| refractive index | 1.6310 (estimate) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White |
| λmax | 302nm(EtOH)(lit.) |
| BRN | 153970 |
| InChI | InChI=1S/C11H6O3/c12-10-4-2-7-1-3-9-8(5-6-13-9)11(7)14-10/h1-6H |
| InChIKey | XDROKJSWHURZGO-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2C3C=COC=3C=CC=2C=C1 |
| LogP | 2.080 |
| CAS DataBase Reference | 523-50-2(CAS DataBase Reference) |
| IARC | 3 (Vol. 40, Sup 7) 1987 |
| NIST Chemistry Reference | 2H-furo[2,3-h]-1-benzopyran-2-one(523-50-2) |
Description and Uses
Angelicin is a furanocoumarin typically isolated from the seeds of P. corylifolia. Like other furanocoumarins, angelicin has antibacterial activities against a number of Gram (+) and Gram (-) bacteria. It has also been shown to prevent tacrine-
Antifungal
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P301+P312+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38-40 |
| Safety Statements | 26-36/37/39-37/39-36 |
| WGK Germany | 3 |
| RTECS | LV0940000 |
| HS Code | 29322090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 523-50-2(Hazardous Substances Data) |







