A7092258
                    Angelicin , 10mMinDMSO , 523-50-2
                            Synonym(s):
2H-Furo[2,3-h]-1-benzopyran-2-one;2-Oxo-(2H)-furo(2,3-h)-1-benzopyran;Isopsoralen;NSC 404563
                            
                        
                CAS NO.:523-50-2
Empirical Formula: C11H6O3
Molecular Weight: 186.16
MDL number: MFCD00064930
EINECS: 637-055-0
| Pack Size | Price | Stock | Quantity | 
| 1ml | RMB239.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 132-134°C | 
                                    
| Boiling point: | 104°C/4mmHg(lit.) | 
                                    
| Density | 1.2477 (rough estimate) | 
                                    
| refractive index | 1.6310 (estimate) | 
                                    
| storage temp. | Sealed in dry,Store in freezer, under -20°C | 
                                    
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | 
                                    
| form | Solid | 
                                    
| color | White | 
                                    
| λmax | 302nm(EtOH)(lit.) | 
                                    
| BRN | 153970 | 
                                    
| InChI | InChI=1S/C11H6O3/c12-10-4-2-7-1-3-9-8(5-6-13-9)11(7)14-10/h1-6H | 
                                    
| InChIKey | XDROKJSWHURZGO-UHFFFAOYSA-N | 
                                    
| SMILES | C1(=O)OC2C3C=COC=3C=CC=2C=C1 | 
                                    
| LogP | 2.080 | 
                                    
| CAS DataBase Reference | 523-50-2(CAS DataBase Reference) | 
                                    
| IARC | 3 (Vol. 40, Sup 7) 1987 | 
                                    
| NIST Chemistry Reference | 2H-furo[2,3-h]-1-benzopyran-2-one(523-50-2) | 
                                    
Description and Uses
                                            Angelicin is a furanocoumarin typically isolated from the seeds of P. corylifolia. Like other furanocoumarins, angelicin has antibacterial activities against a number of Gram (+) and Gram (-) bacteria. It has also been shown to prevent tacrine-
Antifungal
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H302-H315-H319-H335 | 
| Precautionary statements | P301+P312+P330-P302+P352-P305+P351+P338 | 
| Hazard Codes | Xn,Xi | 
| Risk Statements | 20/21/22-36/37/38-40 | 
| Safety Statements | 26-36/37/39-37/39-36 | 
| WGK Germany | 3 | 
| RTECS | LV0940000 | 
| HS Code | 29322090 | 
| Hazardous Substances Data | 523-50-2(Hazardous Substances Data) | 







