A7093912
Quinhydrone , 97% , 106-34-3
Synonym(s):
Hydroquinone: benzoquinone 1:1 complex;Quinhydrone
CAS NO.：106-34-3
Empirical Formula: C12H10O4
Molecular Weight: 218.21
MDL number: MFCD00010310
EINECS: 203-387-6
| Pack Size | Price | Stock | Quantity |
| 25G | RMB50.40 | In Stock |
|
| 100G | RMB149.60 | In Stock |
|
| 250g | RMB343.20 | In Stock |
|
| 500G | RMB569.60 | In Stock |
|
| 2.5kg | RMB2144.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 167-172 °C (lit.) |
| Boiling point: | 285 °C |
| Density | 1.32 |
| bulk density | 300kg/m3 |
| refractive index | 1.4270 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | 4g/l |
| form | Crystalline Powder |
| Specific Gravity | 0.863 (20/4℃) |
| color | Dark green |
| Water Solubility | 4 g/L (20 ºC) |
| Sensitive | Light Sensitive |
| Merck | 14,8058 |
| BRN | 3919222 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C6H6O2.C6H4O2/c2*7-5-1-2-6(8)4-3-5/h1-4,7-8H;1-4H |
| InChIKey | BDJXVNRFAQSMAA-UHFFFAOYSA-N |
| SMILES | Oc1ccc(O)cc1.O=C2C=CC(=O)C=C2 |
| LogP | 0.644 (est) |
| CAS DataBase Reference | 106-34-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Quinhydrone(106-34-3) |
| EPA Substance Registry System | Quinhydrone (106-34-3) |
Description and Uses
In pH determinations (quinhydrone electrode).
Safety
| Symbol(GHS) |   GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H400 |
| Precautionary statements | P264-P270-P273-P301+P310-P391-P405 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 22-36/37/38-50 |
| Safety Statements | 26-36-61-37/39-29 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | VA4550000 |
| TSCA | TSCA listed |
| HS Code | 2942 00 00 |
| HazardClass | 6.1 |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 |
| Toxicity | LD50 orally in rats: 225 mg/kg (Woodward) |
