A7094412
8-Quinolinol hemisulfate salt , 98% , 134-31-6
Synonym(s):
8-Hydroxyquinoline hemisulfate salt;8-Quinolinol hemisulfate salt
CAS NO.：134-31-6
Empirical Formula: 2C9H7NO.H2O4S
Molecular Weight: 388.4
MDL number: MFCD00013095
EINECS: 205-137-1
| Pack Size | Price | Stock | Quantity |
| 25G | RMB24.80 | In Stock |
|
| 100G | RMB64.80 | In Stock |
|
| 500G | RMB280.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~175 °C |
| Density | 1.3819 (rough estimate) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.5364 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | crystalline |
| color | yellow |
| Water Solubility | >=10 g/100 mL at 19 ºC |
| Merck | 14,4843 |
| BRN | 3760550 |
| Major Application | pharmaceutical (small molecule) |
| Cosmetics Ingredients Functions | ANTIMICROBIAL CHELATING |
| Cosmetic Ingredient Review (CIR) | 8-Hydroxyquinoline sulfate (134-31-6) |
| InChI | 1S/2C9H7NO.H2O4S/c2*11-8-5-1-3-7-4-2-6-10-9(7)8;1-5(2,3)4/h2*1-6,11H;(H2,1,2,3,4) |
| InChIKey | MRUMAIRJPMUAPZ-UHFFFAOYSA-N |
| SMILES | OS(O)(=O)=O.Oc1cccc2cccnc12.Oc3cccc4cccnc34 |
| LogP | 2.42 at 25℃ |
| CAS DataBase Reference | 134-31-6(CAS DataBase Reference) |
| EPA Substance Registry System | 8-Quinolinol sulfate (134-31-6) |
Description and Uses
8-Hydroxyquinoline sulfate is used to control grey mould (Botrytis cinevea) in vine grafting. It is also used as a soil sterilant against damping off in seed beds.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36 |
| RIDADR | 2811 |
| WGK Germany | 1 |
| RTECS | VC8260000 |
| F | 3-10 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
