A7096012
3-Quinuclidone hydrochloride , 99% , 1193-65-3
Synonym(s):
1-Azabicyclo[2.2.2]octan-3-one hydrochloride
CAS NO.：1193-65-3
Empirical Formula: C7H12ClNO
Molecular Weight: 161.63
MDL number: MFCD00137391
EINECS: 214-776-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB52.00 | In Stock |
|
| 25G | RMB132.80 | In Stock |
|
| 100G | RMB445.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C (dec.)(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | H2O: 0.1 g/mL, clear |
| form | Powder |
| color | White to off-white |
| Sensitive | Hygroscopic |
| BRN | 3695039 |
| InChI | InChI=1/C7H11NO.ClH/c9-7-5-8-3-1-6(7)2-4-8;/h6H,1-5H2;1H |
| InChIKey | RFDPHKHXPMDJJD-UHFFFAOYSA-N |
| SMILES | [C@@]12([H])CCN(CC1)CC2=O.Cl |&1:0,r| |
| LogP | -1.65 |
| CAS DataBase Reference | 1193-65-3(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Azabicyclo[2.2.2]octan-3-one, hydrochloride (1193-65-3) |
Description and Uses
3-Quinuclidinone Hydrochloride is used in the synthesis of cevimeline, a thiolating agent. Also used in the preparation of novel CB1 and CB2 cannabinoid receptor ligands.
Safety
| Symbol(GHS) |  GHS09 |
| Signal word | Warning |
| Hazard statements | H411 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37/39-26 |
| WGK Germany | 3 |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
