A7096512
Quercetin 3-D-galactoside , Analysis of standard products, ≥98% , 482-36-0
Synonym(s):
3,3′,4′,5,7-Pentahydroxyflavone 3-D -galactoside;Hyperin;Hyperoside;Quercetin 3-D -galactoside
CAS NO.:482-36-0
Empirical Formula: C21H20O12
Molecular Weight: 464.38
MDL number: MFCD00016933
EINECS: 207-580-6
| Pack Size | Price | Stock | Quantity |
| 20MG | RMB206.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 225-226°C |
| Boiling point: | 872.6±65.0 °C(Predicted) |
| Density | 1.87±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| pka | 6.17±0.40(Predicted) |
| color | Light Yellow to Yellow |
| BRN | 5784795 |
| Major Application | pharmaceutical small molecule |
| InChIKey | OVSQVDMCBVZWGM-WBVCLXJUNA-N |
| SMILES | O([C@H]1[C@@H]([C@@H](O)[C@@H](O)[C@@H](CO)O1)O)C1C(C2=C(C=C(O)C=C2OC=1C1C=CC(O)=C(O)C=1)O)=O |&1:1,2,3,5,7,r| |
| LogP | -0.111 (est) |
| CAS DataBase Reference | 482-36-0(CAS DataBase Reference) |
Description and Uses
Hypericin, which is widely found in various plants, such as Hypericum, Rosaceae, Campanulaceae, Labiatae, Rhododendron, Asteraceae Kwai, Garciniaceae, Leguminosae, Euonymus, and other fruits and whole grass, is a flavonoid compound.
It may be used as calibration standard solutions in method validation of polyphenols from leaf extracts using HPLC method.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22-40 |
| Safety Statements | 22-45-36-24/25 |
| WGK Germany | 3 |
| RTECS | DJ3009200 |
| F | 10-23 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |






