A7096912
Quinchlorac , Analysis standard product, 98% , 84087-01-4
Synonym(s):
3,7-Dichloro-8-quinolinecarboxylic acid
CAS NO.:84087-01-4
Empirical Formula: C10H5Cl2NO2
Molecular Weight: 242.06
MDL number: MFCD00072495
EINECS: 402-780-1
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB286.40 | In Stock |
|
| 5g | RMB7999.20 | In Stock |
|
| 25g | RMB30071.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 274°C |
| Boiling point: | 405.4±40.0 °C(Predicted) |
| Density | 1.7500 |
| refractive index | 1.6100 (estimate) |
| Flash point: | 100 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | -3.26±0.10(Predicted) |
| color | Pale Yellow |
| BRN | 7761858 |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C10H5Cl2NO2/c11-6-3-5-1-2-7(12)8(10(14)15)9(5)13-4-6/h1-4H,(H,14,15) |
| InChIKey | FFSSWMQPCJRCRV-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=C(Cl)C=2C(O)=O)C=C(Cl)C=1 |
| EPA Substance Registry System | Quinclorac (84087-01-4) |
Description and Uses
Quinclorac is a disubstituted quinolinecarboxylic acid that is part of a new class of highly selective auxin herbicides. Quinclorac is used in rice to control dicotyledonous and monocotyledonous weeds, particularly barnyardgrass (Echinochloa crus-galli). Quinclorac is also used for weed control in turfgrasses.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P280-P302+P352 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 43 |
| Safety Statements | 2-24-37 |
| WGK Germany | 2 |
| RTECS | VB1984000 |
| HS Code | 29334900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |
| Hazardous Substances Data | 84087-01-4(Hazardous Substances Data) |





