A7097012
Quizalofop-ethyl , Analysis standard product, 96% , 76578-14-8
Synonym(s):
Ethyl 2-[4-(6-chloro-2-quinoxalinyloxy)phenoxy]propionate
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92-93° |
| Boiling point: | bp0.2 220° |
| Density | 1.2671 (rough estimate) |
| refractive index | 1.6800 (estimate) |
| Flash point: | 100 °C |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | -1.39±0.48(Predicted) |
| Water Solubility | 303ug/L(temperature not stated) |
| Merck | 13,8178 |
| BRN | 7145610 |
| Major Application | agriculture environmental |
| InChI | 1S/C19H17ClN2O4/c1-3-24-19(23)12(2)25-14-5-7-15(8-6-14)26-18-11-21-17-10-13(20)4-9-16(17)22-18/h4-12H,3H2,1-2H3 |
| InChIKey | OSUHJPCHFDQAIT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)Oc1ccc(Oc2cnc3cc(Cl)ccc3n2)cc1 |
| LogP | 4.280 |
| CAS DataBase Reference | 76578-14-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Assure(76578-14-8) |
| EPA Substance Registry System | Quizalofop-ethyl (76578-14-8) |
Description and Uses
Quizalofop-ethyl is a selective postemergence herbicide used to control both annual and perennial grasses in soybeans and cotton.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302+H312-H400 |
| Precautionary statements | P273-P280-P301+P312+P330-P302+P352+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 21/22 |
| Safety Statements | 22-24/25 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | UA2458255 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Oral Aquatic Acute 1 |
| Hazardous Substances Data | 76578-14-8(Hazardous Substances Data) |
| Toxicity | LD50 in male, female rats, male, female mice (mg/kg): 1670, 1480, 2350, 2360 orally; all 10,000 dermally; LC50 (96 hr) in rainbow trout: 10.7 mg/l (Sakata) |






