A7098312
Quinoxyfen , Analysis standard , 124495-18-7
Synonym(s):
(5,7-Dichloro-4-quinolyl) (4-fluorophenyl) ether
CAS NO.:124495-18-7
Empirical Formula: C15H8Cl2FNO
Molecular Weight: 308.13
MDL number: MFCD03265638
EINECS: 602-997-3
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB686.40 | In Stock |
|
| 200mg | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 105-106° |
| Boiling point: | 423℃ |
| Density | 1.430 |
| vapor pressure | 1.2 x 10-5 Pa (20 °C) |
| Flash point: | >100 °C |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| Water Solubility | 0.12 mg l-1 (20 °C) |
| pka | 2.87±0.50(Predicted) |
| color | White to Light yellow |
| Merck | 14,8079 |
| Major Application | agriculture environmental |
| InChI | 1S/C15H8Cl2FNO/c16-9-7-12(17)15-13(8-9)19-6-5-14(15)20-11-3-1-10(18)2-4-11/h1-8H |
| InChIKey | WRPIRSINYZBGPK-UHFFFAOYSA-N |
| SMILES | Fc1ccc(Oc2ccnc3cc(Cl)cc(Cl)c23)cc1 |
| LogP | 5.1 at 20℃ |
| Dissociation constant | 3.56 |
| EPA Substance Registry System | Quinoxyfen (124495-18-7) |
Description and Uses
Quinoxyfen is under development for the control of powdery mildew in cereals and grapes.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H410 |
| Precautionary statements | P261-P272-P273-P280-P302+P352-P333+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi,N |
| Risk Statements | 43-50/53 |
| Safety Statements | 24-37-46-60-61 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | VB4287500 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 38220090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1B |
| Hazardous Substances Data | 124495-18-7(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: >5000 mg/kg; dermally in rabbits: >2000 mg/kg; by inhalation in rats: >3.38 mg/l (Longhurst) |





