A7099558
AlimemazineTartrate , 10mMinDMSO , 4330-99-8
Synonym(s):
Alimemazine hemitartrate
CAS NO.:4330-99-8
Empirical Formula: C40H50N4O6S2
Molecular Weight: 746.98
MDL number: MFCD00242594
EINECS: 224-368-9
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 153-155°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMF: 10 mg/ml; DMSO: 10 mg/ml; Ethanol: 5 mg/ml; PBS (pH 7.2): insol |
| form | Solid |
| color | White to Almost white |
| Merck | 14,9704 |
| Major Application | pharmaceutical (small molecule) |
| InChIKey | ZEEPCWVFSHMOPI-MVELKYERNA-N |
| SMILES | C(N1C2=CC=CC=C2SC2C=CC=CC1=2)C(C)CN(C)C.[C@H](O)(C(=O)O)[C@@H](O)C(=O)O |&1:21,26,r| |
| CAS DataBase Reference | 4330-99-8(CAS DataBase Reference) |
Description and Uses
Antipruritic. Antibacterial, antimicrobial agent
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P330+P331+P310 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36 |
| RIDADR | 3249 |
| WGK Germany | 3 |
| RTECS | SO6475000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2934302700 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |




