A7103458
D-Glucurone , 10mMinDMSO , 32449-92-6
Synonym(s):
D- (+)-Glucurono-6,3-lactone;D -Glucurone;D -Glucurono-6,3-lactone;Glucuronolactone
CAS NO.:32449-92-6
Empirical Formula: C6H8O6
Molecular Weight: 176.12
MDL number: MFCD00135622
EINECS: 251-053-3
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 172-175 °C (lit.) |
| Boiling point: | 227.71°C (rough estimate) |
| alpha | 19 º (c=10, H2O) |
| Density | 1,76 g/cm3 |
| refractive index | 18.5 ° (C=5, H2O) |
| storage temp. | Store below +30°C. |
| solubility | water: soluble25mg/mL, clear, colorless |
| form | Crystals or Crystalline Powder |
| pka | 11.96±0.60(Predicted) |
| color | White |
| Odor | at 100.00 %. very mild mentholic |
| Odor Type | mentholic |
| optical activity | [α]24/D +18.8°, c = 8 in H2O |
| Water Solubility | SOLUBLE |
| Merck | 14,4467 |
| BRN | 83595 |
| Major Application | clinical testing |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | 1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h1-5,8-10H/t2-,3+,4-,5+/m0/s1 |
| InChIKey | OGLCQHRZUSEXNB-IEPORWDDSA-N |
| SMILES | O=C([C@@H]([C@@H](O1)[C@H](O)[C@H](O)C1=O)O)[H] |
| LogP | -3.457 (est) |
| CAS DataBase Reference | 32449-92-6(CAS DataBase Reference) |
| EPA Substance Registry System | D-Glucuronolactone (32449-92-6) |
Description and Uses
D-Glucurono-6,3-lactone is a glucuronic acid derivative studied for its effectiveness against canine hepatitis. It is utilized in the studies such as starting regent in the synthesis of 2,3,4,-tris(tert.-butyldimethysilyl) glucuronic acid trichloroethylester, required for the preparation of 1-O-acyl glucuronide of the anti-inflammatory drug ML-3000, synthesis of optically active glucopyranoses, synthesis of long-chain alkyl glucofuranosides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 2 |
| RTECS | LZ8930000 |
| TSCA | TSCA listed |
| HS Code | 29322980 |
| Storage Class | 11 - Combustible Solids |





