A7111612
Reserpine , ≥98.0%(HPLC) , 50-55-5
Synonym(s):
(3β, 16β, 17α, 18β, 20α)-11,17-Dimethoxy-18-[(3,4,5-trimethoxybenzoyl)oxy]yohimban-16-carboxylic acid methyl ester;Reserpine;Reserpine - CAS 50-55-5 - Calbiochem;VMAT2 Inhibitor, Reserpine, Vesicular monoamine transporter (VMAT) Antagonist, Reserpine
CAS NO.:50-55-5
Empirical Formula: C33H40N2O9
Molecular Weight: 608.69
MDL number: MFCD00005091
EINECS: 200-047-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB156.00 | In Stock |
|
| 5G | RMB531.20 | In Stock |
|
| 25G | RMB2639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~265 °C (dec.) |
| alpha | D23 -118° (CHCl3); D26 -164° (c = 0.96 in pyridine); D26 -168° (c = 0.624 in DMF) |
| Boiling point: | 655.12°C (rough estimate) |
| Density | 1.2336 (rough estimate) |
| refractive index | 177 ° (C=1, DMF) |
| Flash point: | 22℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Practically insoluble in water, very slightly soluble in ethanol (96 per cent). |
| pka | 6.6(at 25℃) |
| form | Solid |
| color | Off-white |
| optical activity | [α]20/D 123±3°, c = 1% in chloroform |
| Water Solubility | Soluble in water. |
| Merck | 14,8145 |
| BRN | 102014 |
| Stability: | Stable, but darkens slowly in light. Combustible. Incompatible with strong acids, reducing agents, oxidizing agents. |
| InChIKey | QEVHRUUCFGRFIF-MDEJGZGSSA-N |
| SMILES | CO[C@H]1[C@@H](C[C@@H]2CN3CCc4c([nH]c5cc(OC)ccc45)[C@H]3C[C@@H]2[C@@H]1C(=O)OC)OC(=O)c6cc(OC)c(OC)c(OC)c6 |
| LogP | 4.050 (est) |
| CAS DataBase Reference | 50-55-5 |
| NIST Chemistry Reference | Reserpine(50-55-5) |
| IARC | 3 (Vol. 24, Sup 7) 1987 |
| EPA Substance Registry System | Reserpine (50-55-5) |
Description and Uses
Reserpine causes release of norepinephrine, dopamine, and serotonin at neuronal termini. It weakens the intracellular uptake of biogenic amines and decreases the ability to store them in vesicles.
An indole alkaloid found in Rauwolfia serpentina. Inhibits vesicular uptake of catecholamines and serotonin. Reserpine is reasonably anticipated to be a human carcinogen. Antihypertensive.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H336-H351-H360D |
| Precautionary statements | P201-P301+P312+P330-P308+P313 |
| target organs | Central nervous system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-67-36-10 |
| Safety Statements | 22-36/37/39-26 |
| RIDADR | 3077 |
| WGK Germany | 3 |
| RTECS | ZG0350000 |
| F | 10-23 |
| TSCA | TSCA listed |
| PackingGroup | II |
| HS Code | 29399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Repr. 1A STOT SE 3 |
| Hazardous Substances Data | 50-55-5(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: 420mg/kg |






