A7112812
Riboflavine , 98% , 83-88-5
Synonym(s):
Riboflavin;Vitamin B2;Riboflavine;(?)-Riboflavin;Lactoflavin
CAS NO.:83-88-5
Empirical Formula: C17H20N4O6
Molecular Weight: 376.36
MDL number: MFCD00005022
EINECS: 201-507-1
| Pack Size | Price | Stock | Quantity |
| 25G | RMB56.00 | In Stock |
|
| 100G | RMB171.20 | In Stock |
|
| 250G | RMB397.60 | In Stock |
|
| 500G | RMB652.00 | In Stock |
|
| 2.5kg | RMB2749.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 290 °C (dec.)(lit.) |
| alpha | -135 º (c=5, 0.05 M NaOH) |
| Boiling point: | 504.93°C (rough estimate) |
| Density | 1.2112 (rough estimate) |
| bulk density | 100kg/m3 |
| refractive index | -135 ° (C=0.5, JP Method) |
| Flash point: | 9℃ |
| storage temp. | 2-8°C |
| solubility | Very slightly soluble in water, practically insoluble in ethanol (96 per cent). Solutions deteriorate on exposure to light, especially in the presence of alkali. It shows polymorphism (5.9). |
| form | Powder |
| pka | 1.7(at 25℃) |
| color | Yellow to orange |
| Odor | Slight odour |
| PH Range | 6 |
| PH | 5.5-7.2 (0.07g/l, H2O, 20°C) |
| biological source | synthetic |
| optical activity | [α]/D -135.0 to -155.0°, c =0.5% in 0.05 M NaOH (dry basis) |
| Water Solubility | 0.07 g/L (20 ºC) |
| Sensitive | Light Sensitive |
| Merck | 14,8200 |
| BRN | 97825 |
| BCS Class | 1 |
| Stability: | Stable, but light-sensitive. Incompatible with strong oxidizing agents, reducing agents, bases, calcium, metallic salts. May be moisture sensitive. |
| Cosmetics Ingredients Functions | SKIN CONDITIONING - MISCELLANEOUS COLORANT |
| InChI | 1S/C17H20N4O6/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)19-15/h3-4,11-12,14,22-25H,5-6H2,1-2H3,(H,20,26,27)/t11-,12+,14-/m0/s1 |
| InChIKey | AUNGANRZJHBGPY-SCRDCRAPSA-N |
| SMILES | CC1=C(C)C=C(N(C[C@H](O)[C@@H]([C@H](O)CO)O)C(C2=N3)=NC(NC2=O)=O)C3=C1 |
| LogP | -2.009 (est) |
| CAS DataBase Reference | 83-88-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Riboflavine(83-88-5) |
| EPA Substance Registry System | Riboflavin (83-88-5) |
Description and Uses
A water-soluble B fraction was found in the 1920s to contain a yellow, fluorescent growth factor called riboflavin in England and vitamin G in the United States. In the early 1930s, several groups found the coenzyme forms of riboflavin 50-phosphate (flavin mononucleotide) and the further conjugate with adenylic acid (flavin adenine dinucleotide).
Nutritional factor found in milk, eggs, malted barley, liver, kidney, heart, leafy vegetables. Richest natural source is yeast. Minute amounts present in all plant and animal cells. Vitamin (enzyme cofactor).
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H226-H301+H311+H331-H370 |
| Precautionary statements | P210-P280-P301+P310+P330-P302+P352+P312-P304+P340+P311 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 24/25-45-36/37-16 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 1 |
| RTECS | VJ1400000 |
| F | 8-10-21 |
| TSCA | TSCA listed |
| HS Code | 29362300 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 83-88-5(Hazardous Substances Data) |
| Toxicity | LD50 in rats (g/kg): >10 orally, 5.0 s.c., 0.56 i.p. (Unna, Greslin) |






