A7114112
Rhodamine B , Analysis of standard products,> 99.0%(HPLC) , 81-88-9
Synonym(s):
Basic Violet 10;Brilliant Pink B;Rhodamine O;Tetraethylrhodamine;Tetraethylrhodamine, Brilliant pink B
CAS NO.:81-88-9
Empirical Formula: C28H31ClN2O3
Molecular Weight: 479.01
MDL number: MFCD00011931
EINECS: 201-383-9
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB152.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210-211 (dec.)(lit.) |
| Density | 0.79 g/mL at 20 °C |
| bulk density | 250kg/m3 |
| refractive index | 1.6500 (estimate) |
| Flash point: | 12 °C |
| storage temp. | room temp |
| solubility | H2O: soluble1mg/mL |
| Colour Index | 45170 |
| form | Solid |
| color | Green |
| PH | 3-4 (10g/l, H2O, 20℃) |
| Water Solubility | SOLUBLE |
| ε(extinction coefficient) | 104500-115800 at 542-554nm in methanol |
| Merck | 14,8183 |
| BRN | 4119648 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | cleaning products cosmetics food and beverages personal care |
| Cosmetics Ingredients Functions | COLORANT |
| InChI | 1S/C28H30N2O3.ClH/c1-5-29(6-2)19-13-15-23-25(17-19)33-26-18-20(30(7-3)8-4)14-16-24(26)27(23)21-11-9-10-12-22(21)28(31)32;/h9-18H,5-8H2,1-4H3;1H |
| InChIKey | PYWVYCXTNDRMGF-UHFFFAOYSA-N |
| SMILES | [Cl-].CCN(CC)c1ccc2c(OC3=CC(\C=CC3=C2c4ccccc4C(O)=O)=[N+](/CC)CC)c1 |
| LogP | 1.9-2 |
| CAS DataBase Reference | 81-88-9(CAS DataBase Reference) |
| IARC | 3 (Vol. 16, Sup 7) 1987 |
| NIST Chemistry Reference | Rhodamine b(81-88-9) |
| EPA Substance Registry System | Rhodamine B (81-88-9) |
Description and Uses
C.I. Food red 15 is a green crystalline or redviolet powdered solid. Molecular weight =479.1. HazardIdentification (based on NFPA-704 M Rating System):Health 1, Flammability 1, Reactivity 0. Highly soluble inwater.
A useful fluorochrome for histology, FRET and mitochondrial probe.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H319-H336 |
| Precautionary statements | P210-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi,F |
| Risk Statements | 22-41-68-67-36-11-40-20/21/22-52/53 |
| Safety Statements | 7-16-24/25-26-36/37/39-39-36-22 |
| WGK Germany | 3 |
| RTECS | BP3675000 |
| TSCA | TSCA listed |
| HS Code | 32041300 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Eye Dam. 1 |
| Hazardous Substances Data | 81-88-9(Hazardous Substances Data) |
| Toxicity | LD50 i.v. in rats: 89.5 mg/kg (Webb) |





