A7115012
Rhodamine B isothiocyanate , mixtureofisomers , 36877-69-7
Synonym(s):
RBITC
CAS NO.：36877-69-7
Empirical Formula: C29H30N3O3S.Cl
Molecular Weight: 536.09
MDL number: MFCD00041787
EINECS: 253-248-9
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB736.80 | In Stock |
|
| 500MG | RMB2581.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | -20°C |
| solubility | methanol: soluble10mg/mL |
| form | powder |
| color | Green to dark green |
| λmax | 555 nm |
| Stability: | Stable, but may be sensitive to light or moisture. Store dark and dry. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C29H29N3O3S.ClH/c1-5-31(6-2)19-12-14-21-25(16-19)35-26-17-20(32(7-3)8-4)13-15-22(26)27(21)28-23(29(33)34)10-9-11-24(28)30-18-36;/h9-17H,5-8H2,1-4H3;1H |
| InChIKey | ASPXTKVHMNAXGJ-UHFFFAOYSA-N |
| SMILES | C1(=C2C=C/C(=[N+](\CC)/CC)/C=C2OC2C=C(N(CC)CC)C=CC1=2)C1=C(C(=O)O)C=CC=C1N=C=S.[Cl-] |
| CAS DataBase Reference | 36877-69-7(CAS DataBase Reference) |
| EPA Substance Registry System | Xanthylium, 9-[2-carboxy-5(or 6)-isothiocyanatophenyl]-3,6-bis(diethylamino)-, chloride (36877-69-7) |
Description and Uses
Rhodamine B isothiocyanate is used for the following applications:
- Rhodamine isothiocyanate labeling
- Rhodamine-labeled synthetic APF
- Preparations of protein and fluorescent conjugates
- Fluorescent red dye
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H315-H319-H334-H335 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38-42-48/20 |
| Safety Statements | 22-26-45 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| F | 8-10-21 |
| HS Code | 29329990 |
