A7116912
Rutin hydrate , >98.0%(T) , 207671-50-9
CAS NO.:207671-50-9
Empirical Formula: C27H32O17
Molecular Weight: 628.54
MDL number: MFCD01319140
EINECS: 683-619-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB66.40 | In Stock |
|
| 25G | RMB132.80 | In Stock |
|
| 100G | RMB386.40 | In Stock |
|
| 500G | RMB838.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 195°C (dec.) (lit.) |
| solubility | pyridine: soluble50mg/mL |
| form | powder |
| color | yellow to green |
| Merck | 14,8304 |
| BRN | 75455 |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChIKey | PGHSKTKIQIBATG-ZAAWVBGYSA-N |
| SMILES | [H]O[H].O[C@H]1[C@H](OC[C@H]([C@H]2O)O[C@@H](OC(C3=O)=C(C4=CC=C(O)C(O)=C4)OC5=C3C(O)=CC(O)=C5)[C@H](O)[C@H]2O)O[C@H]([C@@H]([C@H]1O)O)C |
| CAS DataBase Reference | 207671-50-9 |
Description and Uses
Rutin hydrate is a vitamin drug that can be used to prevent and treat hypertensive cerebral hemorrhage; diabetic retinal hemorrhage and hemorrhagic purpura, etc., and is also used as a food antioxidant and pigment.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| RTECS | VM2975000 |
| HS Code | 2938.10.0000 |
| Storage Class | 11 - Combustible Solids |






