A7123612
(R)-(+)-2-[2-(Diphenylphosphino)phenyl]-4-isopropyl-2-oxazol , 98% , 164858-78-0
Synonym(s):
(R)-(+)-2-[2-(Diphenylphosphino)phenyl]-4,5-dihydro-4-isopropyl-oxazole
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB1199.20 | In Stock |
|
| 500MG | RMB4799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 85-90 °C |
| alpha | +44° (c 1.4, CHCl3) |
| Boiling point: | 492.7±28.0 °C(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 4.31±0.70(Predicted) |
| form | Powder |
| color | white |
| optical activity | [α]20/D +48±3°, c = 1.4% in chloroform |
| Sensitive | air sensitive |
| BRN | 8156604 |
| InChI | InChI=1S/C24H24NOP/c1-18(2)22-17-26-24(25-22)21-15-9-10-16-23(21)27(19-11-5-3-6-12-19)20-13-7-4-8-14-20/h3-16,18,22H,17H2,1-2H3/t22-/m0/s1 |
| InChIKey | OUQSAXROROGQEE-QFIPXVFZSA-N |
| SMILES | O1C[C@@H](C(C)C)N=C1C1=CC=CC=C1P(C1=CC=CC=C1)C1=CC=CC=C1 |
| CAS DataBase Reference | 164858-78-0 |
Description and Uses
Used as asymmetric alkylation reactions with iridium catalysts; chiral ligands for asymmetric reduction reactions.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-24/25 |
| WGK Germany | 3 |
| F | 10-23 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |

![(R)-(+)-2-[2-(Diphenylphosphino)phenyl]-4-isopropyl-2-oxazol](https://img.chemicalbook.com/CAS/GIF/164858-78-0.gif)





![(S)-1-(Diphenylphosphino)-2-[(S)-4-isopropyloxazolin-2-yl]ferrocene](https://img.chemicalbook.com/CAS/20210111/GIF/163169-29-7.gif)