A7123912
(1R,2R)-(+)-1,2-Diphenylethylenediamine , 99% , 35132-20-8
Synonym(s):
(1R,2R)- DPEDA;(1R,2R)-(+)-1,2-Diamino-1,2-diphenylethane;(1R,2R)-DPEN
CAS NO.:35132-20-8
Empirical Formula: C14H16N2
Molecular Weight: 212.29
MDL number: MFCD00082769
EINECS: 609-071-8
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB32.00 | In Stock |
|
| 1G | RMB72.80 | In Stock |
|
| 5G | RMB85.60 | In Stock |
|
| 25G | RMB758.40 | In Stock |
|
| 100G | RMB1464.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 79-83 °C(lit.) |
| alpha | 104 º (c=1.1, MeOH 25 ºC) |
| Boiling point: | 342.14°C (rough estimate) |
| Density | 1.0799 (rough estimate) |
| refractive index | 103 ° (C=1, EtOH) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 9.78±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to light yellow |
| optical activity | [α]20/D +102°, c = 1 in ethanol |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| BRN | 2369988 |
| Stability: | Hygroscopic |
| InChI | 1S/C14H16N2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-14H,15-16H2/t13-,14-/m1/s1 |
| InChIKey | PONXTPCRRASWKW-ZIAGYGMSSA-N |
| SMILES | N[C@@H]([C@H](N)c1ccccc1)c2ccccc2 |
| CAS DataBase Reference | 35132-20-8(CAS DataBase Reference) |
Description and Uses
(1R,2R)-(+)-1,2-Diphenylethylenediamine is a chiral reagent widely used in the chemical industry at present, used for asymmetric synthesis and optical resolution.
(1R,2R)-(+)-1,2-Diphenyl-1,2-ethanediamine is used as chiral solvation agent for determination of enantiomeric excess of chiral acids by NMR. It is used in various catalyst systems for asymmetric reactions.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-23 |
| HazardClass | 8 |
| HS Code | 29212900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





