A7124112
(R,R)-(-)-N,N′-Dimethyl-1,2-cyclohexanediamine , ≥97.0%(GC) , 68737-65-5
Synonym(s):
(R,R)-(−)-N,N′-Dimethyl-1,2-diaminocyclohexane;trans-1,2-Bis(methylamino)cyclohexane
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB27.20 | In Stock |
|
| 1G | RMB30.40 | In Stock |
|
| 250MG | RMB44.00 | In Stock |
|
| 5g | RMB107.20 | In Stock |
|
| 25g | RMB375.20 | In Stock |
|
| 100g | RMB1423.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 39-44 °C |
| alpha | -145 º (c=4.47 in chloroform) |
| Boiling point: | 249.85°C (rough estimate) |
| Density | 0.902 |
| refractive index | -140 ° (C=4, CHCl3) |
| Flash point: | 74 °C |
| storage temp. | 2-8°C |
| pka | 11.04±0.40(Predicted) |
| form | Low Melting Solid |
| color | White to light yellow |
| optical activity | [α]/D -145±5°, c = 4.47 in chloroform |
| InChI | InChI=1S/C8H18N2/c1-9-7-5-3-4-6-8(7)10-2/h7-10H,3-6H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | JRHPOFJADXHYBR-HTQZYQBOSA-N |
| SMILES | [C@@H]1(NC)CCCC[C@H]1NC |
| CAS DataBase Reference | 68737-65-5(CAS DataBase Reference) |
Description and Uses
(R,R)-(?)-N,N′-Dimethyl-1,2-cyclohexanediamine can be used:
- As a ligand in the preparation of 4H-benzo[f]imidazo[1,4]diazepin-6-one through multi-component Ullmann coupling reaction.
- In one of the key synthetic steps for the preparation of tricyclic γ-secretase modulators.
- To prepare chiral fluorous diamino-diol proligand, which is used in the synthesis of zirconium metal complexes applicable as catalysts in 1-hexene polymerization.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P270-P280-P301+P312-P301+P330+P331-P303+P361+P353-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34-22 |
| Safety Statements | 45-36/37/39-25-26 |
| RIDADR | 3259 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | Ⅱ |
| HS Code | 29213000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |






