A7128412
Rivastigmine , ≥99% , 123441-03-2
Synonym(s):
N-Ethyl-N-methylcarbamic acid 3-[(1S)-1-(dimethylamino)ethyl]phenyl-ester;Ethylmethyl-carbamic acid 3-[(1S)-1-(dimethylamino)ethyl]phenyl ester;N-Ethyl-N-methyl-carbamic acid 3-[(1S)-1-(dimethylamino)ethyl]phenyl ester tartrate;Rivastigmine tartrate;S-Rivastigmine tartrate
CAS NO.：123441-03-2
Empirical Formula: C14H22N2O2
Molecular Weight: 250.34
MDL number: MFCD00871496
EINECS: 602-936-0
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB183.20 | In Stock |
|
| 100MG | RMB431.20 | In Stock |
|
| 500MG | RMB1092.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | D20 -32.1° (c = 5 in ethanol) |
| Boiling point: | 316.2±34.0 °C(Predicted) |
| Density | 1.038±0.06 g/cm3(Predicted) |
| Flash point: | 145℃ |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly) |
| form | Powder |
| pka | pKa 8.99 (Uncertain) |
| color | Colorless to light yellow |
| InChI | InChI=1S/C14H22N2O2/c1-6-16(5)14(17)18-13-9-7-8-12(10-13)11(2)15(3)4/h7-11H,6H2,1-5H3/t11-/m0/s1 |
| InChIKey | XSVMFMHYUFZWBK-NSHDSACASA-N |
| SMILES | C(OC1=CC=CC([C@@H](N(C)C)C)=C1)(=O)N(CC)C |
| CAS DataBase Reference | 123441-03-2(CAS DataBase Reference) |
Description and Uses
Antidepressant
Safety
| Symbol(GHS) |   GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H300-H411 |
| Precautionary statements | P264-P270-P273-P301+P310-P391-P405 |
| RIDADR | UN 2810 6.1 / PGIII |
| HS Code | 2924296000 |
