A7132912
Risedronate , ≥99.0% , 105462-24-6
CAS NO.:105462-24-6
Empirical Formula: C7H11NO7P2
Molecular Weight: 283.11
MDL number: MFCD00867080
EINECS: 600-654-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB36.80 | In Stock |
|
| 5G | RMB112.80 | In Stock |
|
| 25G | RMB376.80 | In Stock |
|
| 50g | RMB639.20 | In Stock |
|
| 100G | RMB1004.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >232°C (subl.) |
| Boiling point: | 692.3±65.0 °C(Predicted) |
| Density | 1.870±0.06 g/cm3(Predicted) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | Aqueous Base (Slightly), Methanol (Very Slightly, Heated, Sonicated) |
| pka | 1.41±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C7H11NO7P2/c9-7(16(10,11)12,17(13,14)15)4-6-2-1-3-8-5-6/h1-3,5,9H,4H2,(H2,10,11,12)(H2,13,14,15) |
| InChIKey | IIDJRNMFWXDHID-UHFFFAOYSA-N |
| SMILES | C(P(=O)(O)O)(P(=O)(O)O)(O)CC1=CC=CN=C1 |
| CAS DataBase Reference | 105462-24-6(CAS DataBase Reference) |
| EPA Substance Registry System | Phosphonic acid, P,P'-[1-hydroxy-2-(3-pyridinyl)ethylidene]bis- (105462-24-6) |
Description and Uses
Risedronic Acid is a pyridinyl biphosphonate bone resorption inhibitor. It is a potentially useful biophosphonate for bone resorption analysis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| Hazardous Substances Data | 105462-24-6(Hazardous Substances Data) |
| REACH Registrations | Active |



