A7134812
Rimantadine , ≥98% , 13392-28-4
Synonym(s):
1-(Aminomethyl)adamantane
CAS NO.:13392-28-4
Empirical Formula: C12H21N
Molecular Weight: 179.3
MDL number: MFCD00869344
EINECS: 1308068-626-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB554.40 | In Stock |
|
| 5G | RMB2391.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 248°C |
| Density | 1.033 |
| Flash point: | 99°C |
| storage temp. | Store at -20°C |
| solubility | Soluble in DMSO |
| form | Liquid |
| pka | 11.17±0.29(Predicted) |
| color | Colorless to light yellow |
| InChI | InChI=1/C12H21N.ClH/c1-8(13)12-5-9-2-10(6-12)4-11(3-9)7-12;/h8-11H,2-7,13H2,1H3;1H/t8,9-,10+,11-,12-; |
| InChIKey | OZBDFBJXRJWNAV-MZHJCFSPNA-N |
| SMILES | [C@]12(C[C@]3([H])C[C@@]([H])(C[C@@]([H])(C3)C1)C2)C(N)C.Cl |&1:0,2,5,8,r| |
| CAS DataBase Reference | 13392-28-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Adamantanemethylamine, «alpha»-methyl-(13392-28-4) |
Description and Uses
Rimantadine act by blocking the M2 ion channel which is required for uptake of protons into the interior of the virus to permit acid-promoted viral uncoating (decapsidation).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| HazardClass | IRRITANT |
| HS Code | 2902190000 |
| Hazardous Substances Data | 13392-28-4(Hazardous Substances Data) |





