A7135312
Rivastigmine Tartrate , ≥98% , 129101-54-8
Synonym(s):
ENA-713;Ethylmethyl-carbamic acid 3-[(1S)-1-(dimethylamino)ethyl]phenyl ester;N-Ethyl-N-methyl-carbamic acid 3-[(1S)-1-(dimethylamino)ethyl]phenyl ester tartrate;Rivastigmine tartrate;S-Rivastigmine tartrate
CAS NO.:129101-54-8
Empirical Formula: C18H28N2O8
Molecular Weight: 400.42
MDL number: MFCD03700731
EINECS: 603-318-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB214.40 | In Stock |
|
| 1G | RMB469.60 | In Stock |
|
| 5G | RMB1877.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 123-1250C |
| alpha | D20 +4.7° (c = 5 in ethanol) |
| storage temp. | 2-8°C |
| solubility | H2O: soluble15mg/mL, clear |
| form | powder |
| color | white to beige |
| optical activity | 3.50°(C=0.01g/mL, MEOH, 589nm) |
| Water Solubility | H2O: 15mg/mL, clear |
| InChI | InChI=1/C14H22N2O2.C4H6O6/c1-6-16(5)14(17)18-13-9-7-8-12(10-13)11(2)15(3)4;5-1(3(7)8)2(6)4(9)10/h7-11H,6H2,1-5H3;1-2,5-6H,(H,7,8)(H,9,10)/t11-;1-,2-/s3 |
| InChIKey | GWHQHAUAXRMMOT-AAUFCPPMNA-N |
| SMILES | C1(=CC=CC([C@H](C)N(C)C)=C1)OC(=O)N(C)CC.[C@H](O)(C(=O)O)[C@@H](O)C(=O)O |&1:5,18,23,r| |
| CAS DataBase Reference | 129101-54-8(CAS DataBase Reference) |
Description and Uses
Nootropic & Alzheimer’s treatment
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H300-H411 |
| Precautionary statements | P264-P270-P273-P301+P310-P391-P405 |
| RIDADR | UN 2811 6.1 / PGII |
| WGK Germany | 3 |
| RTECS | FA9550000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29242990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Aquatic Chronic 2 |






