A7138612
1-(2,4-Dichlorophenyl)-2-(1-imidazolyl)ethanol , ≥98.0% , 24155-42-8
CAS NO.:24155-42-8
Empirical Formula: C11H10Cl2N2O
Molecular Weight: 257.12
MDL number: MFCD00044708
EINECS: 246-042-5
| Pack Size | Price | Stock | Quantity |
| 25G | RMB37.60 | In Stock |
|
| 100G | RMB111.20 | In Stock |
|
| 500g | RMB408.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 134-138 °C |
| Boiling point: | 468.5±45.0 °C(Predicted) |
| Density | 1.4133 (rough estimate) |
| vapor pressure | 0Pa at 20℃ |
| refractive index | 1.5500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 12.25±0.20(Predicted) |
| form | solid |
| color | White to Pale Yellow |
| Water Solubility | 1300 g/L (20 ºC) |
| InChI | 1S/C11H10Cl2N2O/c12-8-1-2-9(10(13)5-8)11(16)6-15-4-3-14-7-15/h1-5,7,11,16H,6H2 |
| InChIKey | UKVLTPAGJIYSGN-UHFFFAOYSA-N |
| SMILES | OC(Cn1ccnc1)c2ccc(Cl)cc2Cl |
| LogP | 2.31 at 20℃ |
| CAS DataBase Reference | 24155-42-8(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Imidazole-1-ethanol, ?-(2,4-dichlorophenyl)- (24155-42-8) |
Description and Uses
Intermediate in the preparation of Miconazole.An impurity in the synthesis of Fenticonazole.An impurity in the synthesis of Ketoconazole.Econazole EP Impurity A.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P301+P312+P330-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 38-28B-36-26 |
| WGK Germany | 3 |
| RTECS | NI5485000 |
| HS Code | 2933290000 |
| Storage Class | 11 - Combustible Solids |




![(S)-6-Phenyl-2,3,5,6-tetrahydroimidazo[2,1-b]thiazole](https://img.chemicalbook.com/CAS/GIF/14769-73-4.gif)
