A7139712
(+/-)-Metanephrine hydrochloride , ≥98%(HPLC) , 881-95-8
CAS NO.:881-95-8
Empirical Formula: C10H16ClNO3
Molecular Weight: 233.69
MDL number: MFCD00012487
EINECS: 212-922-2
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB375.20 | In Stock |
|
| 50MG | RMB1079.20 | In Stock |
|
| 250MG | RMB3335.20 | In Stock |
|
| 1G | RMB7999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 180-182C |
| Density | 1.320 g/cm3 |
| storage temp. | 2-8°C |
| solubility | H2O: soluble |
| form | powder |
| color | white to off-white |
| Water Solubility | H2O: 12mg/mL (clear solution) |
| Stability: | Hygroscopic |
| InChI | 1S/C10H15NO3.ClH/c1-11-6-9(13)7-3-4-8(12)10(5-7)14-2;/h3-5,9,11-13H,6H2,1-2H3;1H |
| InChIKey | HRIQFVCFOPJYEQ-UHFFFAOYSA-N |
| SMILES | OC1=C(OC)C=C(C(CNC)O)C=C1.Cl |
Description and Uses
A metabolite of Epinephrine (E588585). A naturraly occurring derivative of Epinephrine, found in urine and in certain tissues.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | DA4798000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





