A7141612
(±)-Naringenin , 97% , 67604-48-2
Synonym(s):
(±)-2,3-Dihydro-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one;4′,5,7-Trihydroxyflavanone
CAS NO.:67604-48-2
Empirical Formula: C15H12O5
Molecular Weight: 272.25
MDL number: MFCD00006844
EINECS: 266-769-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.80 | In Stock |
|
| 2g | RMB39.20 | In Stock |
|
| 5G | RMB63.20 | In Stock |
|
| 25G | RMB150.40 | In Stock |
|
| 100G | RMB424.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 247-250 °C (lit.) |
| Boiling point: | 577.5±50.0 °C(Predicted) |
| Density | 1.485 |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 7.52±0.40(Predicted) |
| form | Solid |
| color | Pale Yellow to Pale Brown |
| biological source | Citrus paradisi Macf. |
| Water Solubility | Soluble in ethanol (50 mg/ml), DMSO, methanol, and ammonium hydroxide (50 mg/ml). Insoluble in water (almost) |
| Merck | 14,6424 |
| InChI | InChI=1S/C15H12O5/c16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13/h1-6,13,16-18H,7H2 |
| InChIKey | FTVWIRXFELQLPI-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(O)C=C2)OC2=CC(O)=CC(O)=C2C(=O)C1 |
| CAS DataBase Reference | 67604-48-2(CAS DataBase Reference) |
Description and Uses
A PI 3-kinase inhibitor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3077 |
| WGK Germany | 3 |
| RTECS | DJ2981530 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |




