A7142112
Rimsulfuron , 96% , 122931-48-0
Synonym(s):
1-(4,6-Dimethoxy-2-pyrimidinyl)-3-[3-(ethylsulfonyl)-2-pyridylsulfonyl]urea
CAS NO.:122931-48-0
Empirical Formula: C14H17N5O7S2
Molecular Weight: 431.44
MDL number: MFCD01632305
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB236.00 | In Stock |
|
| 1G | RMB632.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 172-177°C |
| Density | 1.4918 (rough estimate) |
| refractive index | 1.6460 (estimate) |
| Flash point: | >200 °C |
| storage temp. | 0-6°C |
| solubility | DMSO (Slightly), Methanol (Very Slightly, Heated) |
| pka | 4.1(at 25℃) |
| form | Solid |
| color | White to Pale Beige |
| BRN | 7501778 |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C14H17N5O7S2/c1-4-27(21,22)9-6-5-7-15-12(9)28(23,24)19-14(20)18-13-16-10(25-2)8-11(17-13)26-3/h5-8H,4H2,1-3H3,(H2,16,17,18,19,20) |
| InChIKey | MEFOUWRMVYJCQC-UHFFFAOYSA-N |
| SMILES | C1(S(NC(NC2=NC(OC)=CC(OC)=N2)=O)(=O)=O)=NC=CC=C1S(CC)(=O)=O |
| CAS DataBase Reference | 122931-48-0(CAS DataBase Reference) |
| EPA Substance Registry System | Rimsulfuron (122931-48-0) |
Description and Uses
Rimsulfuron is used as a pesticide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| RIDADR | UN3077(solid) |
| WGK Germany | 1 |
| RTECS | UT7900000 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 122931-48-0(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: >5000 mg/kg; dermally in rabbits: >2000 mg/kg (Palm) |






