A7142312
(R)-(+)-α-Amino-γ-butyrolactone hydrochloride , ≥97.0% , 104347-13-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB96.00 | In Stock |
|
| 5G | RMB311.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 220-224 °C |
| alpha | 28 º (c=1, H2O) |
| storage temp. | Inert atmosphere,Room Temperature |
| Water Solubility | Soluble in water |
| form | Powder, Solid or Crystalline Powder |
| color | Yellow to brown |
| optical activity | [α]23/D +28°, c = 1 in H2O |
| Major Application | peptide synthesis |
| InChI | InChI=1/C4H7NO2.ClH/c5-3-1-2-7-4(3)6;/h3H,1-2,5H2;1H/t3-;/s3 |
| InChIKey | XBKCXPRYTLOQKS-OQFXAWDINA-N |
| SMILES | [C@@H]1(N)CCOC1=O.Cl |&1:0,r| |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2914390090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



