A7150112
(<i>R</i>)-(-)-1-Methoxy-2-propanol , >96.0%(GC) , 4984-22-9
Synonym(s):
(R)-(−)-Propylene glycol 1-methyl ether
CAS NO.:4984-22-9
Empirical Formula: C4H10O2
Molecular Weight: 90.12
MDL number: MFCD01632587
EINECS: 628-460-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB35.20 | In Stock |
|
| 5G | RMB118.40 | In Stock |
|
| 25G | RMB332.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -97 °C |
| Boiling point: | 119-121 °C (lit.) |
| Density | 0.921 g/mL at 20 °C (lit.) |
| refractive index | n |
| Flash point: | 33 °C |
| storage temp. | Sealed in dry,2-8°C |
| pka | 14.49±0.20(Predicted) |
| form | Liquid |
| color | Clear colorless |
| optical activity | [α]20/D 22±2°, c = 10% in chloroform |
| BRN | 1718941 |
| InChI | InChI=1S/C4H10O2/c1-4(5)3-6-2/h4-5H,3H2,1-2H3/t4-/m1/s1 |
| InChIKey | ARXJGSRGQADJSQ-SCSAIBSYSA-N |
| SMILES | C(OC)[C@H](O)C |
| CAS DataBase Reference | 4984-22-9(CAS DataBase Reference) |
Description and Uses
(R)-(-)-1-Methoxy-2-propanol can be used as a reactant to prepare:
- (S)-3-(ethoxycarbonyl)-5-((1-methoxypropan-2-yl)oxy)benzoic acid, a key intermediate to synthesize phenylethyl benzamide derivatives, which can be used as glucokinase activators.
- Chiral pyrazolopyrimidinone derivatives as potential phosphodiesterase enzyme (PDE5) inhibitors.
- Aryl or alkyl ethers via etherification reaction.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H320-H336-H226 |
| Precautionary statements | P501-P261-P240-P210-P233-P243-P241-P242-P271-P264-P280-P370+P378-P337+P313-P305+P351+P338-P303+P361+P353-P304+P340+P312-P403+P233-P403+P235-P405 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xn |
| Risk Statements | 10-15 |
| Safety Statements | 24-43-7/8 |
| RIDADR | UN 3092 3/PG 3 |
| WGK Germany | 1 |
| HazardClass | 3 |
| PackingGroup | Ⅲ |
| HS Code | 29051990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |





