A7184712
(1R,4S)-4-hydroxycyclopent-2-en-1-yl acetate , 95% , 60410-16-4
Synonym(s):
(1R,3S)-(+)-cis-4-Cyclopentene-1,3-diol 1-acetate;(1R,3S)-4-Cyclopentene-1,3-diol 1-acetate;(1R,4S)-cis-4-Hydroxy-2-cyclopentenyl acetate
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB344.80 | In Stock |
|
| 1G | RMB915.20 | In Stock |
|
| 5g | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 49-52 °C |
| Boiling point: | 208.0±40.0 °C(Predicted) |
| Density | 1.17±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| form | Low Melting Solid |
| pka | 14.11±0.40(Predicted) |
| color | Off-white to beige |
| optical activity | [α]20/D +68°, c = 2.3 in chloroform |
| BRN | 4663992 |
| InChI | InChI=1S/C7H10O3/c1-5(8)10-7-3-2-6(9)4-7/h2-3,6-7,9H,4H2,1H3/t6-,7+/m1/s1 |
| InChIKey | IJDYOKVVRXZCFD-RQJHMYQMSA-N |
| SMILES | [C@H]1(OC(=O)C)C=C[C@@H](O)C1 |
Description and Uses
(1S,4R)-cis-4-Acetoxy-2-cyclopenten-1-ol can be used as:
- A building block for the synthesis of biologically significant carbocyclic nucleosides and prostaglandins.
- A starting material in the synthesis of azasugar analogs.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | IRRITANT |
| HS Code | 29162000 |


