A7205812
(1R,2R)-(-)-N,N-Dimethylcyclohexane-1,2-diamine , 98% , 320778-92-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB23.20 | In Stock |
|
| 250mg | RMB36.00 | In Stock |
|
| 1g | RMB86.40 | In Stock |
|
| 5G | RMB343.20 | In Stock |
|
| 25g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 180℃ |
| Density | 0.92 |
| Flash point: | 62℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 10.52±0.70(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C8H18N2/c1-10(2)8-6-4-3-5-7(8)9/h7-8H,3-6,9H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | FRDZGSBXKJXGNR-HTQZYQBOSA-N |
| SMILES | [C@@H]1(N(C)C)CCCC[C@H]1N |
Description and Uses
(1R,2R)-2-N,2-N-dimethylcyclohexane-1,2-diamine is a chiral amine catalysts used in asymmetric direct aldol and Michael addition reactions.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |






