A7212712
(R)-N-Fmoc-2-(7-octenyl)Alanine , 95% , 945212-26-0
Synonym(s):
(R)-N-Fmoc-α-(7-Octenyl)alanine;Fmoc-(R)-2-(7-octenyl)alanine;Fmoc-(R)-2-amino-2-methyl-dec-6-enoic acid
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB96.00 | In Stock |
|
| 100mg | RMB206.40 | In Stock |
|
| 250MG | RMB324.80 | In Stock |
|
| 1g | RMB1154.40 | In Stock |
|
| 5g | RMB6348.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 588.3±45.0 °C(Predicted) |
| Density | 1.140 |
| storage temp. | -20°C |
| form | liquid |
| pka | 3.94±0.41(Predicted) |
| color | pale yellow |
| InChIKey | MADFVGMQNXRFAF-AREMUKBSSA-N |
| SMILES | C(O)(=O)[C@@](NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)(C)CCCCCCC=C |
Description and Uses
(2R)-2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-2-methyl-9-decenoic Acid, is a stable antimicrobial peptide, that can be isolated from the venom of wild bee Lasioglossum laticeps.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H400 |
| Precautionary statements | P273 |
| Hazard Codes | N |
| Risk Statements | 50 |
| Safety Statements | 61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | 9 |
| HS Code | 2922498590 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







