A7256712
Sodium 1-decanesulfonate , 98% , 13419-61-9
Synonym(s):
1-Decanesulfonic acid sodium salt;1-Decanesulfonic Acid, Sodium Salt, Anhydrous;Decane Sulfuric Acid;Decane-1-sulfonic acid sodium salt;Sodium 1-decanesulphonate
CAS NO.：13419-61-9
Empirical Formula: C10H21NaO3S
Molecular Weight: 244.33
MDL number: MFCD00007526
EINECS: 236-525-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB25.60 | In Stock |
|
| 5G | RMB68.80 | In Stock |
|
| 25G | RMB183.20 | In Stock |
|
| 100G | RMB697.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C (lit.) |
| storage temp. | Store below +30°C. |
| solubility | H2O: 0.05 g/mL, clear |
| Colour Index | 45400 |
| form | Crystalline Powder |
| color | White to cream |
| Water Solubility | soluble |
| Sensitive | Hygroscopic |
| λmax | λ: 210 nm Amax: 0.05 λ: 220 nm Amax: 0.03 λ: 230 nm Amax: 0.02 λ: 260 nm Amax: 0.02 λ: 500 nm Amax: 0.02 |
| BRN | 3918920 |
| Stability: | Stable. Hygroscopic. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C10H22O3S.Na/c1-2-3-4-5-6-7-8-9-10-14(11,12)13;/h2-10H2,1H3,(H,11,12,13);/q;+1/p-1 |
| InChIKey | AIMUHNZKNFEZSN-UHFFFAOYSA-M |
| SMILES | C(CS([O-])(=O)=O)CCCCCCCC.[Na+] |
| CAS DataBase Reference | 13419-61-9(CAS DataBase Reference) |
Description and Uses
Ion-associating reagent for HPLC, including analyses of peptides and proteins.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-24/25-37/39 |
| WGK Germany | 3 |
| HS Code | 29049090 |
