A7259712
Salvianolic acid B , Analysis of standard products, ≥98% , 115939-25-8
Synonym(s):
;Dan Shen Suan B;Danfensuan B;Lithospermic acid B;Salvianolic acid B
| Pack Size | Price | Stock | Quantity |
| 20MG | RMB186.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >149oC (dec.) |
| storage temp. | -20°C Freezer |
| solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Pale Yellow to Yellow |
| biological source | plant |
| Water Solubility | water: soluble |
| InChIKey | SNKFFCBZYFGCQN-UXMWXTSRNA-N |
| SMILES | [C@@H]1(C(=O)O[C@H](CC2C=CC(O)=C(O)C=2)C(O)=O)C2C(=CC=C(O)C=2O[C@H]1C1=CC=C(O)C(O)=C1)/C=C/C(=O)O[C@H](CC1=CC=C(O)C(O)=C1)C(O)=O |&1:0,4,25,39,r| |
| LogP | 2.140 (est) |
Description and Uses
Salvianolic acid A (Sal A) and salvianolic acid B (Sal B) were isolated and purified from the crude extract of Salvia miltiorrhiza. Antioxidant activities of Sal A and Sal B were also evaluated and the ABTS results showed that Sal A and Sal B exhibited high total antioxidant activities, their EC50 values were 1.35 0.00 and 1.43 0.01 .mu.g/mL. This compound always contains a significant amount of residual solvent.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| HS Code | 29329990 |
