PRODUCT Properties
| Melting point: | 281-285°C |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | methanol: 20 mg/mL, clear, orange |
| form | Orange solid. |
| color | Orange to Dark Orange |
| Water Solubility | H2O: slightly soluble <0.3mg/mL methanol: 3.8mg/mL |
| Stability: | Hygroscopic, Light Sensitive |
| InChI | InChI=1S/C20H14NO4.ClH/c1-21-8-15-12(4-5-16-20(15)25-10-22-16)13-3-2-11-6-17-18(24-9-23-17)7-14(11)19(13)21;/h2-8H,9-10H2,1H3;1H/q+1;/p-1 |
| InChIKey | GIZKAXHWLRYMLE-UHFFFAOYSA-M |
| SMILES | C12[N+](C)=CC3=C4OCOC4=CC=C3C1=CC=C1C=C3OCOC3=CC=21.[Cl-] |
Description and Uses
antineoplastic, antiplaque agent
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36-26 |
| WGK Germany | 3 |
| RTECS | VP5220000 |
| F | 10 |
| HS Code | 29399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |







![Benzo[<i>h</i>]quinoline](https://img.chemicalbook.com/CAS/GIF/230-27-3.gif)