A7264612
Sodium 2,3-dimercapto-1-propanesulfonate , 95% , 4076-02-2
CAS NO.:4076-02-2
Empirical Formula: C3H7NaO3S3
Molecular Weight: 210.27
MDL number: MFCD00007523
EINECS: 223-796-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB120.80 | In Stock |
|
| 1G | RMB340.80 | In Stock |
|
| 5G | RMB1279.20 | In Stock |
|
| 10G | RMB1999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 215 °C (dec.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | H2O: 0.1 g/mL, clear |
| Merck | 14,3210 |
| BRN | 3734863 |
| InChI | InChI=1S/C3H8O3S3.Na/c4-9(5,6)2-3(8)1-7;/h3,7-8H,1-2H2,(H,4,5,6);/q;+1/p-1 |
| InChIKey | FGGPAWQCCGEWTJ-UHFFFAOYSA-M |
| SMILES | S([O-])(=O)(=O)CC(S)CS.[Na+] |
| CAS DataBase Reference | 4076-02-2(CAS DataBase Reference) |
Description and Uses
Sodium 2,?3-?Dimercaptopropane-?1-?sulfonate can be used in engineering or chemical process of preparation method of rare earth modified graphene reinforced metal matrix composite bar.
Safety
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| RTECS | TZ6420000 |
| F | 10-23 |


