Sodium trifluoromethanesulfonate , 98% , 2926-30-9
Synonym(s):
Sodium triflate;Trifluoromethanesulfonic acid sodium salt
| Pack Size | Price | Stock | Quantity |
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB126.40 | In Stock |
|
| 100G | RMB479.20 | In Stock |
|
| 500g | RMB1835.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 253-255 °C (lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Powder |
| color | White to off-white |
| Water Solubility | soluble |
| Sensitive | Hygroscopic |
| Hydrolytic Sensitivity | 0: forms stable aqueous solutions |
| BRN | 3728797 |
| InChI | InChI=1S/CHF3O3S.Na/c2-1(3,4)8(5,6)7;/h(H,5,6,7);/q;+1/p-1 |
| InChIKey | KKVTYAVXTDIPAP-UHFFFAOYSA-M |
| SMILES | C(F)(F)(F)S([O-])(=O)=O.[Na+] |
| CAS DataBase Reference | 2926-30-9(CAS DataBase Reference) |
Description and Uses
Sodium trifluoromethanesulfonate is commonly known as trifluoromethanesulfonic acid or TFMS. Possessing unique properties, TFMS is water-soluble, anionic, and boasts a range of valuable attributes. As a colorless, odorless, and non-toxic substance, TFMS finds widespread use as a reagent in organic synthesis, a catalyst in industrial applications, and a buffer in various biochemical experiments. In scientific research, TFMS stands out due to its robust acidity, enabling it to act as a potent catalyst in organic synthesis. Additionally, it effectively serves as a reliable buffer at pH levels, ensuring precise pH maintenance in biochemical experiments. As an anionic compound, TFMS functions as a strong acid in solution, facilitating the donation of protons to other molecules, thus reducing the pH.
Sodium trifluoromethanesulfonate can be employed as a reagent for the preparation of:
- Aryl fluorides via silver-catalyzed fluorination of arylstannanes.
- Ionic liquids such as N, N -dialkylpyrrolidinium triflate, N,N-dialkylimidazolium triflate, and N-alkylpyridinium triflate.
It can be also used as supporting electrolyte in electrochemical O-glycosylation of primary alcohols with O-protected thioglycosides.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,C,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| F | 3-10 |
| Hazard Note | Corrosive |
| TSCA | No |
| HS Code | 29049090 |
