A7267912
(S)-(-)-1,1-Diphenyl-1,2-propanediol , 99% , 46755-94-6
CAS NO.：46755-94-6
Empirical Formula: C15H16O2
Molecular Weight: 228.29
MDL number: MFCD00134287
EINECS: 258-258-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB159.20 | In Stock |
|
| 5G | RMB365.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 89-92 °C(lit.) |
| Boiling point: | 406.6±40.0 °C(Predicted) |
| Density | 1.152±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 13.28±0.29(Predicted) |
| optical activity | [α]25/D 100°, c = 1 in methanol |
| BRN | 3202232 |
| InChI | 1S/C15H16O2/c1-12(16)15(17,13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-12,16-17H,1H3/t12-/m0/s1 |
| InChIKey | RQKXFLUAQLDHMO-LBPRGKRZSA-N |
| SMILES | C[C@H](O)C(O)(c1ccccc1)c2ccccc2 |
Description and Uses
Chiral glycol for the synthesis of chiral sulfoxides and epoxides.
Safety
| Symbol(GHS) |    GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H302+H312-H315-H318-H411 |
| Precautionary statements | P264-P270-P273-P280-P301+P312+P330-P302+P352+P312-P305+P351+P338+P310-P332+P313-P391-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
