A7270112
Safranine T , Indicator , 477-73-6
Synonym(s):
Safranin O;Safranin T;Basic Red 2;Basic Red 2, Aniline Rose;Cotton Red
CAS NO.:477-73-6
Empirical Formula: C20H19ClN4
Molecular Weight: 350.85
MDL number: MFCD00011759
EINECS: 207-518-8
| Pack Size | Price | Stock | Quantity |
| 10G | RMB51.20 | In Stock |
|
| 50G | RMB191.20 | In Stock |
|
| 250g | RMB804.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >240℃ (decompose) |
| Boiling point: | 507.14°C (rough estimate) |
| Density | 1.00 g/mL at 20 °C |
| bulk density | 400kg/m3 |
| refractive index | n |
| Flash point: | 46 °C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | H2O: soluble1mg/mL |
| form | Solid |
| pka | 6.4(at 25℃) |
| Colour Index | 50240 |
| color | S. No.: 967 |
| PH | 10 (10g/l, H2O, 20℃) |
| Water Solubility | soluble |
| λmax | 530 nm |
| BRN | 3924099 |
| Stability: | Stable. |
| Biological Applications | Hematotoxicity assays; measuring membrane potential; detecting microorganisms; treating diabetes-associated pain,mechanical allodynia,oncological diseases; food packaging materials |
| Major Application | diagnostic assay manufacturing hematology histology |
| Cosmetics Ingredients Functions | HAIR DYEING |
| InChI | 1S/C20H18N4.ClH/c1-12-8-17-19(10-15(12)21)24(14-6-4-3-5-7-14)20-11-16(22)13(2)9-18(20)23-17;/h3-11H,1-2H3,(H3,21,22);1H |
| InChIKey | OARRHUQTFTUEOS-UHFFFAOYSA-N |
| SMILES | [Cl-].Cc1cc2nc3cc(C)c(N)cc3[n+](-c4ccccc4)c2cc1N |
| EPA Substance Registry System | 3,7-Diamino-2,8-dimethyl-5-phenylphenazinium chloride (477-73-6) |
Description and Uses
A biological stain used to stain Gram negative bacteria, chromosomes, mucin, cartilage and mast cells. Dyes and metabolites, Environmental Testing
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H318 |
| Precautionary statements | P280-P305+P351+P338+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 41-36/38-37/38-10-36/37/38 |
| Safety Statements | 26-39-24/25-36-16 |
| RIDADR | UN 1170 3/PG 3 |
| WGK Germany | 3 |
| RTECS | SG1623000 |
| TSCA | TSCA listed |
| HS Code | 32041300 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |
| Hazardous Substances Data | 477-73-6(Hazardous Substances Data) |



