A7278712
Sodium iodoacetate , 98% , 305-53-3
Synonym(s):
Iodoacetic acid sodium salt;Iodoacetic Acid, Sodium Salt - CAS 305-53-3 - Calbiochem
CAS NO.：305-53-3
Empirical Formula: C2H2INaO2
Molecular Weight: 207.93
MDL number: MFCD00002686
EINECS: 206-165-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB36.00 | In Stock |
|
| 5G | RMB102.40 | In Stock |
|
| 25G | RMB342.40 | In Stock |
|
| 100G | RMB1316.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 208 °C (dec.)(lit.) |
| storage temp. | -20°C |
| solubility | methanol: 0.1 M at 20 °C, clear, colorless |
| form | Powder |
| color | Light yellow to yellow-brown |
| biological source | synthetic (organic) |
| Water Solubility | water: 100mg/mL |
| BRN | 4009322 |
| InChI | InChI=1S/C2H3IO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1 |
| InChIKey | AGDSCTQQXMDDCV-UHFFFAOYSA-M |
| SMILES | C([O-])(=O)CI.[Na+] |
| CAS DataBase Reference | 305-53-3(CAS DataBase Reference) |
| EPA Substance Registry System | Acetic acid, iodo-, sodium salt (305-53-3) |
| Absorption | cut-off at 335nm in methanol at 0.1M |
Description and Uses
Reagent for the modification of cysteine residues in proteins. Used to induce animal osteoarthritis model system, which mimics both symptoms and histopathology of the human disease.
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H314 |
| Precautionary statements | P260-P270-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | T,Xn |
| Risk Statements | 25-37/38-41-20/21/22-36/37/38 |
| Safety Statements | 26-39-45-36-36/37/39-22 |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | AI3675000 |
| F | 3-8-10 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29159000 |
