A7279012
D(-)-Salicin , 99% , 138-52-3
Synonym(s):
D -(−)-Salicin;2-(Hydroxymethyl)phenyl-β-D -glucopyranoside;Salicoside;Salicyl alcohol glucoside;Saligenin β-D -glucoside
CAS NO.:138-52-3
Empirical Formula: C13H18O7
Molecular Weight: 286.28
MDL number: MFCD00006590
EINECS: 205-331-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB40.00 | In Stock |
|
| 25G | RMB147.20 | In Stock |
|
| 100G | RMB481.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 196-202 °C |
| alpha | -61.5 º (c=5, water) |
| Boiling point: | 388.65°C (rough estimate) |
| Density | 1.4340 |
| refractive index | -62 ° (C=3, H2O) |
| storage temp. | 2-8°C |
| solubility | 36g/l |
| pka | 12.80±0.70(Predicted) |
| form | Fine Crystalline Powder |
| color | White |
| Water Solubility | 36 g/L (15 ºC), 250 g/L (60 ºC) |
| Merck | 14,8324 |
| BRN | 89593 |
| Stability: | Stable, but light sensitive. Incompatible with strong oxidizing agents. |
| Major Application | cleaning products cosmetics flavors and fragrances food and beverages personal care |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | 1S/C13H18O7/c14-5-7-3-1-2-4-8(7)19-13-12(18)11(17)10(16)9(6-15)20-13/h1-4,9-18H,5-6H2/t9-,10-,11+,12-,13-/m1/s1 |
| InChIKey | NGFMICBWJRZIBI-MICYEWLZSA-N |
| SMILES | OC[C@H]1O[C@@H](Oc2ccccc2CO)[C@H](O)[C@@H](O)[C@@H]1O |
| LogP | -1.232 (est) |
| CAS DataBase Reference | 138-52-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Salicin(138-52-3) |
| EPA Substance Registry System | .beta.-D-Glucopyranoside, 2-(hydroxymethyl)phenyl (138-52-3) |
Description and Uses
D-(-)-Salicin has been used:
- to study its in vitro anticoagulant and antiplatelet activities
- as a standard in high performance liquid chromatography method (HPLC) for quantitation of salicin from willow plant
- as a tastant in taste threshold assay
- as a constituent of nutrient agar-salicin medium for selective isolation of Lactobacillus paracasei
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P280-P302+P352 |
| Hazard Codes | Xi |
| Risk Statements | 43 |
| Safety Statements | 36/37-37-24/25-36 |
| WGK Germany | 3 |
| RTECS | LZ5901700 |
| F | 3-10 |
| TSCA | TSCA listed |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |




